Organic acids and derivatives
Filtered Search Results
Sulfuric acid, for analysis, ca. 96% solution in water
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
Cerium(III) trifluoromethanesulfonate, 98%
CAS: 76089-77-5 Molecular Formula: C3CeF9O9S3 Molecular Weight (g/mol): 587.31 MDL Number: MFCD02093899 InChI Key: PHSMPGGNMIPKTH-UHFFFAOYSA-K Synonym: cerium iii trifluoromethanesulfonate,cerium iii triflate,trifluoromethanesulfonic acid cerium iii salt,cerium trifluoromethanesulfonate,cerous triflate,ce otf 3,3cf3o3s.ce,acmc-209p1w,ksc491c9f PubChem CID: 2733941 IUPAC Name: cerium(3+);trifluoromethanesulfonate SMILES: [Ce+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F
| PubChem CID | 2733941 |
|---|---|
| CAS | 76089-77-5 |
| Molecular Weight (g/mol) | 587.31 |
| MDL Number | MFCD02093899 |
| SMILES | [Ce+3].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F |
| Synonym | cerium iii trifluoromethanesulfonate,cerium iii triflate,trifluoromethanesulfonic acid cerium iii salt,cerium trifluoromethanesulfonate,cerous triflate,ce otf 3,3cf3o3s.ce,acmc-209p1w,ksc491c9f |
| IUPAC Name | cerium(3+);trifluoromethanesulfonate |
| InChI Key | PHSMPGGNMIPKTH-UHFFFAOYSA-K |
| Molecular Formula | C3CeF9O9S3 |
n-Butyl propionate, 99+%
CAS: 590-01-2 Molecular Formula: C7H14O2 Molecular Weight (g/mol): 130.19 MDL Number: MFCD00009448 InChI Key: BTMVHUNTONAYDX-UHFFFAOYSA-N Synonym: butyl propionate,n-butyl propionate,propanoic acid, butyl ester,n-butyl propanoate,propionic acid, butyl ester,propionic acid butyl ester,unii-2nxc4ak99e,butyl propionate natural,fema no. 2211,n-butyl n-propionate PubChem CID: 11529 IUPAC Name: butyl propanoate SMILES: CCCCOC(=O)CC
| PubChem CID | 11529 |
|---|---|
| CAS | 590-01-2 |
| Molecular Weight (g/mol) | 130.19 |
| MDL Number | MFCD00009448 |
| SMILES | CCCCOC(=O)CC |
| Synonym | butyl propionate,n-butyl propionate,propanoic acid, butyl ester,n-butyl propanoate,propionic acid, butyl ester,propionic acid butyl ester,unii-2nxc4ak99e,butyl propionate natural,fema no. 2211,n-butyl n-propionate |
| IUPAC Name | butyl propanoate |
| InChI Key | BTMVHUNTONAYDX-UHFFFAOYSA-N |
| Molecular Formula | C7H14O2 |
Tris(2-butoxyethyl) phosphate, 95%
CAS: 78-51-3 Molecular Formula: C18H39O7P Molecular Weight (g/mol): 398.48 MDL Number: MFCD00009456 InChI Key: WTLBZVNBAKMVDP-UHFFFAOYSA-N Synonym: tris 2-butoxyethyl phosphate,tbep,phosflex t-bep,tris butoxyethyl phosphate,tributoxyethyl phosphate,tri butoxyethyl phosphate,kronitex kp-140,tributyl cellosolve phosphate,ethanol, 2-butoxy-, phosphate 3:1,tri 2-butoxyethyl phosphate PubChem CID: 6540 ChEBI: CHEBI:35038 IUPAC Name: tris(2-butoxyethyl) phosphate SMILES: CCCCOCCOP(=O)(OCCOCCCC)OCCOCCCC
| PubChem CID | 6540 |
|---|---|
| CAS | 78-51-3 |
| Molecular Weight (g/mol) | 398.48 |
| ChEBI | CHEBI:35038 |
| MDL Number | MFCD00009456 |
| SMILES | CCCCOCCOP(=O)(OCCOCCCC)OCCOCCCC |
| Synonym | tris 2-butoxyethyl phosphate,tbep,phosflex t-bep,tris butoxyethyl phosphate,tributoxyethyl phosphate,tri butoxyethyl phosphate,kronitex kp-140,tributyl cellosolve phosphate,ethanol, 2-butoxy-, phosphate 3:1,tri 2-butoxyethyl phosphate |
| IUPAC Name | tris(2-butoxyethyl) phosphate |
| InChI Key | WTLBZVNBAKMVDP-UHFFFAOYSA-N |
| Molecular Formula | C18H39O7P |
Trimethyl phosphonoacetate, 98%
CAS: 5927-18-4 Molecular Formula: C5H11O5P Molecular Weight (g/mol): 182.112 MDL Number: MFCD00008452 InChI Key: SIGOIUCRXKUEIG-UHFFFAOYSA-N Synonym: trimethyl phosphonoacetate,methyl 2-dimethoxyphosphoryl acetate,trimethyl phosphonacetate,trimethylacetyl phosphate,acetic acid, dimethoxyphosphinyl-, methyl ester,methyl-dimethoxyphosphoryl acetat,trimethyl phosphoroacetate,phosphonoacetic acid trimethyl ester,methyl dimethylphosphonoacetate,methyl dimethoxyphosphoryl acetate PubChem CID: 80029 IUPAC Name: methyl 2-dimethoxyphosphorylacetate SMILES: COC(=O)CP(=O)(OC)OC
| PubChem CID | 80029 |
|---|---|
| CAS | 5927-18-4 |
| Molecular Weight (g/mol) | 182.112 |
| MDL Number | MFCD00008452 |
| SMILES | COC(=O)CP(=O)(OC)OC |
| Synonym | trimethyl phosphonoacetate,methyl 2-dimethoxyphosphoryl acetate,trimethyl phosphonacetate,trimethylacetyl phosphate,acetic acid, dimethoxyphosphinyl-, methyl ester,methyl-dimethoxyphosphoryl acetat,trimethyl phosphoroacetate,phosphonoacetic acid trimethyl ester,methyl dimethylphosphonoacetate,methyl dimethoxyphosphoryl acetate |
| IUPAC Name | methyl 2-dimethoxyphosphorylacetate |
| InChI Key | SIGOIUCRXKUEIG-UHFFFAOYSA-N |
| Molecular Formula | C5H11O5P |
Diacetone acrylamide, 99%
CAS: 2873-97-4 Molecular Formula: C9H15NO2 Molecular Weight (g/mol): 169.22 MDL Number: MFCD00008788 InChI Key: OMNKZBIFPJNNIO-UHFFFAOYSA-N Synonym: diacetone acrylamide,diacetoneacrylamide,n-1,1-dimethyl-3-oxobutyl acrylamide,2-propenamide, n-1,1-dimethyl-3-oxobutyl,n-2-methyl-4-oxopentan-2-yl acrylamide,n-2-2-methyl-4-oxopentyl acrylamide,acrylamide, n-1,1-dimethyl-3-oxobutyl,n-1,1-dimethyl-3-oxobutyl-2-propenamide,acrylamide, n,n-diacetonyl,ccris 5898 PubChem CID: 17888 IUPAC Name: N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide SMILES: CC(=O)CC(C)(C)NC(=O)C=C
| PubChem CID | 17888 |
|---|---|
| CAS | 2873-97-4 |
| Molecular Weight (g/mol) | 169.22 |
| MDL Number | MFCD00008788 |
| SMILES | CC(=O)CC(C)(C)NC(=O)C=C |
| Synonym | diacetone acrylamide,diacetoneacrylamide,n-1,1-dimethyl-3-oxobutyl acrylamide,2-propenamide, n-1,1-dimethyl-3-oxobutyl,n-2-methyl-4-oxopentan-2-yl acrylamide,n-2-2-methyl-4-oxopentyl acrylamide,acrylamide, n-1,1-dimethyl-3-oxobutyl,n-1,1-dimethyl-3-oxobutyl-2-propenamide,acrylamide, n,n-diacetonyl,ccris 5898 |
| IUPAC Name | N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide |
| InChI Key | OMNKZBIFPJNNIO-UHFFFAOYSA-N |
| Molecular Formula | C9H15NO2 |
Isatoic anhydride, 97%
CAS: 118-48-9 Molecular Formula: C8H5NO3 Molecular Weight (g/mol): 163.13 MDL Number: MFCD00006700 InChI Key: TXJUTRJFNRYTHH-UHFFFAOYSA-N Synonym: isatoic anhydride,2h-3,1-benzoxazine-2,4 1h-dione,1h-benzo d 1,3 oxazine-2,4-dione,isatoic acid anhydride,4h-3,1-benzoxazine-2,4 1h-dione,isato acid anhydride,n-carboxyanthranilic anhydride,unii-r8tfa74y4u,3,1-benzoxazine-2,4 1h-dione,anthranilic acid, n-carboxy-, cyclic anhydride PubChem CID: 8359 SMILES: O=C1NC2=CC=CC=C2C(=O)O1
| PubChem CID | 8359 |
|---|---|
| CAS | 118-48-9 |
| Molecular Weight (g/mol) | 163.13 |
| MDL Number | MFCD00006700 |
| SMILES | O=C1NC2=CC=CC=C2C(=O)O1 |
| Synonym | isatoic anhydride,2h-3,1-benzoxazine-2,4 1h-dione,1h-benzo d 1,3 oxazine-2,4-dione,isatoic acid anhydride,4h-3,1-benzoxazine-2,4 1h-dione,isato acid anhydride,n-carboxyanthranilic anhydride,unii-r8tfa74y4u,3,1-benzoxazine-2,4 1h-dione,anthranilic acid, n-carboxy-, cyclic anhydride |
| InChI Key | TXJUTRJFNRYTHH-UHFFFAOYSA-N |
| Molecular Formula | C8H5NO3 |
n-Butyl acetate, 99+%
CAS: 123-86-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009445 InChI Key: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC Name: butyl acetate SMILES: CCCCOC(C)=O
| PubChem CID | 31272 |
|---|---|
| CAS | 123-86-4 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:31328 |
| MDL Number | MFCD00009445 |
| SMILES | CCCCOC(C)=O |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| IUPAC Name | butyl acetate |
| InChI Key | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Trisodium Hydrogen Ethylenediaminetetraacetate Hydrate 98.0+%, TCI America™
CAS: 85715-60-2 Molecular Formula: C10H13N2Na3O8 Molecular Weight (g/mol): 358.19 MDL Number: MFCD00149675 InChI Key: QZKRHPLGUJDVAR-UHFFFAOYSA-K Synonym: trisodium hydrogen ethylenediaminetetraacetate hydrate,tricon bw,unii-zmn5a047nl,endrate,edta triasodium salt,zmn5a047nl,ethylenediaminetetraacetic acid trisodium salt hydrate,sequestrene sodium 3,trisodium edta monohydrate,edetate trisodium monohydrate PubChem CID: 16211179 IUPAC Name: trisodium 2-({2-[bis(carboxylatomethyl)amino]ethyl}(carboxymethyl)amino)acetate SMILES: [Na+].[Na+].[Na+].OC(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 16211179 |
|---|---|
| CAS | 85715-60-2 |
| Molecular Weight (g/mol) | 358.19 |
| MDL Number | MFCD00149675 |
| SMILES | [Na+].[Na+].[Na+].OC(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | trisodium hydrogen ethylenediaminetetraacetate hydrate,tricon bw,unii-zmn5a047nl,endrate,edta triasodium salt,zmn5a047nl,ethylenediaminetetraacetic acid trisodium salt hydrate,sequestrene sodium 3,trisodium edta monohydrate,edetate trisodium monohydrate |
| IUPAC Name | trisodium 2-({2-[bis(carboxylatomethyl)amino]ethyl}(carboxymethyl)amino)acetate |
| InChI Key | QZKRHPLGUJDVAR-UHFFFAOYSA-K |
| Molecular Formula | C10H13N2Na3O8 |
Ethyl caprate, 99+%
CAS: 110-38-3 Molecular Formula: C12H24O2 Molecular Weight (g/mol): 200.32 MDL Number: MFCD00009581 InChI Key: RGXWDWUGBIJHDO-UHFFFAOYSA-N Synonym: ethyl caprate,ethyl caprinate,ethyl decylate,decanoic acid ethyl ester,decanoic acid, ethyl ester,capric acid ethyl ester,ethyl n-decanoate,capric acid, ethyl ester,natural,unii-gy39fb86uo PubChem CID: 8048 ChEBI: CHEBI:87430 IUPAC Name: ethyl decanoate SMILES: CCCCCCCCCC(=O)OCC
| PubChem CID | 8048 |
|---|---|
| CAS | 110-38-3 |
| Molecular Weight (g/mol) | 200.32 |
| ChEBI | CHEBI:87430 |
| MDL Number | MFCD00009581 |
| SMILES | CCCCCCCCCC(=O)OCC |
| Synonym | ethyl caprate,ethyl caprinate,ethyl decylate,decanoic acid ethyl ester,decanoic acid, ethyl ester,capric acid ethyl ester,ethyl n-decanoate,capric acid, ethyl ester,natural,unii-gy39fb86uo |
| IUPAC Name | ethyl decanoate |
| InChI Key | RGXWDWUGBIJHDO-UHFFFAOYSA-N |
| Molecular Formula | C12H24O2 |
Hafnium trifluoromethanesulfonate, 98%
CAS: 161337-67-3 Molecular Formula: C4H2F12HfO13S4 Molecular Weight (g/mol): 792.758 MDL Number: MFCD01321255 InChI Key: XQJOFTWVKHJLHA-UHFFFAOYSA-J Synonym: hafnium iv trifluoromethanesulfonate hydrate,hafnium tetrakis trifluoromethanesulfonate , hydrate PubChem CID: 71433309 IUPAC Name: hafnium(4+);trifluoromethanesulfonate;hydrate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].O.[Hf+4]
| PubChem CID | 71433309 |
|---|---|
| CAS | 161337-67-3 |
| Molecular Weight (g/mol) | 792.758 |
| MDL Number | MFCD01321255 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].O.[Hf+4] |
| Synonym | hafnium iv trifluoromethanesulfonate hydrate,hafnium tetrakis trifluoromethanesulfonate , hydrate |
| IUPAC Name | hafnium(4+);trifluoromethanesulfonate;hydrate |
| InChI Key | XQJOFTWVKHJLHA-UHFFFAOYSA-J |
| Molecular Formula | C4H2F12HfO13S4 |
Ethyl trifluoroacetate, 99%
CAS: 383-63-1 Molecular Formula: C4H5F3O2 Molecular Weight (g/mol): 142.08 MDL Number: MFCD00000419 InChI Key: STSCVKRWJPWALQ-UHFFFAOYSA-N Synonym: ethyl trifluoroacetate,trifluoroacetic acid ethyl ester,ethyltrifluoroacetate,acetic acid, trifluoro-, ethyl ester,trifluoroacetic acid, ethyl ester,ethyl trifluoroethanoate,unii-a6tzk6x11x,acetic acid, 2,2,2-trifluoro-, ethyl ester,a6tzk6x11x,ethyl ester of trifluoroacetic acid PubChem CID: 9794 IUPAC Name: ethyl 2,2,2-trifluoroacetate SMILES: CCOC(=O)C(F)(F)F
| PubChem CID | 9794 |
|---|---|
| CAS | 383-63-1 |
| Molecular Weight (g/mol) | 142.08 |
| MDL Number | MFCD00000419 |
| SMILES | CCOC(=O)C(F)(F)F |
| Synonym | ethyl trifluoroacetate,trifluoroacetic acid ethyl ester,ethyltrifluoroacetate,acetic acid, trifluoro-, ethyl ester,trifluoroacetic acid, ethyl ester,ethyl trifluoroethanoate,unii-a6tzk6x11x,acetic acid, 2,2,2-trifluoro-, ethyl ester,a6tzk6x11x,ethyl ester of trifluoroacetic acid |
| IUPAC Name | ethyl 2,2,2-trifluoroacetate |
| InChI Key | STSCVKRWJPWALQ-UHFFFAOYSA-N |
| Molecular Formula | C4H5F3O2 |
N-(n-Butyl)phthalimide, 99%
CAS: 1515-72-6 Molecular Formula: C12H13NO2 Molecular Weight (g/mol): 203.241 MDL Number: MFCD00039695 InChI Key: DLKDEVCJRCPTLN-UHFFFAOYSA-N Synonym: n-butylphthalimide,2-butylisoindoline-1,3-dione,n-n-butyl phthalimide,1-phthalimidobutane,phthalimide, n-butyl,1h-isoindole-1,3 2h-dione, 2-butyl,unii-5th1dkt35e,2-butyl-1h-isoindole-1,3 2h-dione,5th1dkt35e,2-butylbenzo c azoline-1,3-dione PubChem CID: 73812 IUPAC Name: 2-butylisoindole-1,3-dione SMILES: CCCCN1C(=O)C2=CC=CC=C2C1=O
| PubChem CID | 73812 |
|---|---|
| CAS | 1515-72-6 |
| Molecular Weight (g/mol) | 203.241 |
| MDL Number | MFCD00039695 |
| SMILES | CCCCN1C(=O)C2=CC=CC=C2C1=O |
| Synonym | n-butylphthalimide,2-butylisoindoline-1,3-dione,n-n-butyl phthalimide,1-phthalimidobutane,phthalimide, n-butyl,1h-isoindole-1,3 2h-dione, 2-butyl,unii-5th1dkt35e,2-butyl-1h-isoindole-1,3 2h-dione,5th1dkt35e,2-butylbenzo c azoline-1,3-dione |
| IUPAC Name | 2-butylisoindole-1,3-dione |
| InChI Key | DLKDEVCJRCPTLN-UHFFFAOYSA-N |
| Molecular Formula | C12H13NO2 |
Uricase, Candida utilis, Thermo Scientific Chemicals
CAS: 12-4-9002 Molecular Formula: (C3H4O2)n Molecular Weight (g/mol): 72.06 MDL Number: MFCD00084394 InChI Key: NNMHYFLPFNGQFZ-UHFFFAOYSA-M Synonym: acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer PubChem CID: 6581 ChEBI: CHEBI:18308 IUPAC Name: prop-2-enoic acid SMILES: OC(=O)C(-*)C-*
| PubChem CID | 6581 |
|---|---|
| CAS | 12-4-9002 |
| Molecular Weight (g/mol) | 72.06 |
| ChEBI | CHEBI:18308 |
| MDL Number | MFCD00084394 |
| SMILES | OC(=O)C(-*)C-* |
| Synonym | acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer |
| IUPAC Name | prop-2-enoic acid |
| InChI Key | NNMHYFLPFNGQFZ-UHFFFAOYSA-M |
| Molecular Formula | (C3H4O2)n |
Citric acid, trisodium salt dihydrate, 99%, pure
CAS: 1545801 Molecular Formula: C6H9Na3O9 Molecular Weight (g/mol): 294.1 MDL Number: MFCD00150031 InChI Key: NLJMYIDDQXHKNR-UHFFFAOYSA-K Synonym: trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate PubChem CID: 71474 ChEBI: CHEBI:32142 IUPAC Name: trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+]
| PubChem CID | 71474 |
|---|---|
| CAS | 1545801 |
| Molecular Weight (g/mol) | 294.1 |
| ChEBI | CHEBI:32142 |
| MDL Number | MFCD00150031 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+] |
| Synonym | trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate |
| IUPAC Name | trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate |
| InChI Key | NLJMYIDDQXHKNR-UHFFFAOYSA-K |
| Molecular Formula | C6H9Na3O9 |